What is the structure of 4 Propylheptane?
4-Propylheptane
| PubChem CID | 137855 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C10H22 |
| Synonyms | 4-Propylheptane 3178-29-8 Heptane, 4-propyl- Dinoprosttromethamine DTXSID00185644 More… |
| Molecular Weight | 142.28 |
What is the structure of methoxy?
A methoxy group is the functional group consisting of a methyl group bound to oxygen. This alkoxy group has the formula O–CH3. On a benzene ring, the Hammett equation classifies a methoxy substituent at the para position as an electron-donating group, but as an electron-withdrawing group if at the meta position.
What is the structure of OCH3?
Methylthaizolo-OCH3
| PubChem CID | 406286 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C26H22N2O3S |
| Synonyms | Methylthaizolo-OCH3 NSC724338 NSC-724338 |
| Molecular Weight | 442.5 |
What is methoxy chemical formula?
Methoxy | CH3O – PubChem.
What is the structure of 4 Propyloctane?
Identification of 4-propyloctane Chemical Compound
| Chemical Formula | C11H24 |
|---|---|
| IUPAC Name | 4-propyloctane |
| SMILES String | CCCCC(CCC)CCC |
| InChI | InChI=1S/C11H24/c1-4-7-10-11(8-5-2)9-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | VFAMBAFLNKONTN-UHFFFAOYSA-N |
What is the structure of 2 methoxy propane?
C4H10O2-methoxypropane / Formula
What is the structure of 3 methoxy 1 propene?
Allyl methyl ether
| PubChem CID | 69392 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C4H8O |
| Synonyms | Allyl methyl ether 627-40-7 3-methoxyprop-1-ene 1-Propene, 3-methoxy- 3-Methoxy-1-propene More… |
| Molecular Weight | 72.11 |
Is OCH3 Ortho para or meta directing?
The aldehyde group is electron-withdrawing and meta-directing. Okay, this one isn’t so clear. Both –OCH3 and –Ph are activating, ortho-/para-directing groups.
What is OCH3 in Iupac?
1,2−methoxy−butanol.
What is the structure of methoxy benzene?
C7H8OAnisole / Formula
What is the structure of methoxy methane?
C2H6ODimethyl ether / Formula