How many isomers does nonane have?
3.3. 2 Alkanes
| Compound name | Molecular formula | Number of isomers |
|---|---|---|
| Nonane | C9H20 | 35 |
| Decane | C10H22 | 75 |
| Dodecane | C12H26 | 355 |
| Pentadecane | C15H32 | 4,347 |
What is the isomer for 3/4 Dimethylheptane?
View the 3d structure. Stereoisomers: Heptane, 3,4-dimethyl-
What is 3/4 Dimethyloctane a structural isomer of?
3,4-Dimethyloctane
| PubChem CID | 85926 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C10H22 |
| Synonyms | 3,4-Dimethyloctane Octane, 3,4-dimethyl- 15869-92-8 3,4-dimethyl-octane Q5651905 |
| Molecular Weight | 142.28 |
What is the isomer of 3 Methyloctane?
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter. Its refractive index is 1.398 (20 °C, D)….CHEBI:89985.
| Synonyms | Sources |
|---|---|
| 3-Methyl-Heptane | HMDB |
| 3-methylheptane | HMDB |
Which of these compounds is 3/4-Dimethylheptane?
3,4-Dimethylheptane belongs to the class of organic compounds known as branched alkanes. These are acyclic branched hydrocarbons having the general formula CnH2n+2….3D Structure for HMDB0031416 (3,4-Dimethylheptane)
| Value | Source |
|---|---|
| Heptane, 3,4-dimethyl- (8ci)(9ci) | HMDB |
What is the structure of 3/4-Dimethylheptane?
3,4-Dimethylheptane | C9H20 – PubChem.
What is the structure of 3 ethyl 4 4 Dimethylheptane?
3-Ethyl-4,4-dimethylheptane
| PubChem CID | 53425981 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C11H24 |
| Synonyms | 3-ethyl-4,4-dimethylheptane 61868-39-1 DTXSID60699030 |
| Molecular Weight | 156.31 |
How do you write 3-Methyloctane?
3-Methyloctane | C9H20 – PubChem.
Is 3-Methyloctane an alkane?
1 Answer. 3-methyloctane is an alkane.